C27H51N5O7S — CID 158520339
tert-butyl 4-(3-azidopropyl)piperidine-1-carboxylate;tert-butyl 4-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate (PubChem CID 158520339) has the molecular formula C27H51N5O7S and a molecular weight of 589.80 g/mol. Its IUPAC name is tert-butyl 4-(3-azidopropyl)piperidine-1-carboxylate;tert-butyl 4-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-azidopropyl)piperidine-1-carboxylate;tert-butyl 4-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 158520339 |
| Molecular Formula | C27H51N5O7S |
| Molecular Weight | 589.80 g/mol |
| Exact Mass | 589.35 |
| IUPAC Name | tert-butyl 4-(3-azidopropyl)piperidine-1-carboxylate;tert-butyl 4-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCN=[N+]=[N-])CC1.CC(C)(C)OC(=O)N1CCC(CCCOS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C14H27NO5S.C13H24N4O2/c1-14(2,3)20-13(16)15-9-7-12(8-10-15)6-5-11-19-21(4,17)18;1-13(2,3)19-12(18)17-9-6-11(7-10-17)5-4-8-15-16-14/h12H,5-11H2,1-4H3;11H,4-10H2,1-3H3 |
| InChIKey | HMDHUEWTHMXVFO-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 151.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.80 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|