C27H52N2O8S — CID 161252080
tert-butyl 4-(3-hydroxypropyl)piperidine-1-carboxylate;tert-butyl 4-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate (PubChem CID 161252080) has the molecular formula C27H52N2O8S and a molecular weight of 564.79 g/mol. Its IUPAC name is tert-butyl 4-(3-hydroxypropyl)piperidine-1-carboxylate;tert-butyl 4-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-hydroxypropyl)piperidine-1-carboxylate;tert-butyl 4-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 161252080 |
| Molecular Formula | C27H52N2O8S |
| Molecular Weight | 564.79 g/mol |
| Exact Mass | 564.34 |
| IUPAC Name | tert-butyl 4-(3-hydroxypropyl)piperidine-1-carboxylate;tert-butyl 4-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCO)CC1.CC(C)(C)OC(=O)N1CCC(CCCOS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C14H27NO5S.C13H25NO3/c1-14(2,3)20-13(16)15-9-7-12(8-10-15)6-5-11-19-21(4,17)18;1-13(2,3)17-12(16)14-8-6-11(7-9-14)5-4-10-15/h12H,5-11H2,1-4H3;11,15H,4-10H2,1-3H3 |
| InChIKey | VBJZPEMEYYYSAC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.79 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|