C21H40N2O8S — CID 159384798
tert-butyl (3S)-3-hydroxypiperidine-1-carboxylate;tert-butyl (3S)-3-methylsulfonyloxypiperidine-1-carboxylate (PubChem CID 159384798) has the molecular formula C21H40N2O8S and a molecular weight of 480.62 g/mol. Its IUPAC name is tert-butyl (3S)-3-hydroxypiperidine-1-carboxylate;tert-butyl (3S)-3-methylsulfonyloxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-hydroxypiperidine-1-carboxylate;tert-butyl (3S)-3-methylsulfonyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 159384798 |
| Molecular Formula | C21H40N2O8S |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | tert-butyl (3S)-3-hydroxypiperidine-1-carboxylate;tert-butyl (3S)-3-methylsulfonyloxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](O)C1.CC(C)(C)OC(=O)N1CCC[C@H](OS(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H21NO5S.C10H19NO3/c1-11(2,3)16-10(13)12-7-5-6-9(8-12)17-18(4,14)15;1-10(2,3)14-9(13)11-6-4-5-8(12)7-11/h9H,5-8H2,1-4H3;8,12H,4-7H2,1-3H3/t9-;8-/m00/s1 |
| InChIKey | LLJABIQRDIPZQV-PVSSEACSSA-N |
| XLogP | 2.74 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|