C20H15Br3N4O — CID 158521468
3-bromo-7-(2-ethoxyethenyl)-1,5-naphthyridine;3,7-dibromo-1,5-naphthyridine (PubChem CID 158521468) has the molecular formula C20H15Br3N4O and a molecular weight of 567.08 g/mol. Its IUPAC name is 3-bromo-7-(2-ethoxyethenyl)-1,5-naphthyridine;3,7-dibromo-1,5-naphthyridine.
| Compound Name | 3-bromo-7-(2-ethoxyethenyl)-1,5-naphthyridine;3,7-dibromo-1,5-naphthyridine |
|---|---|
| PubChem CID | 158521468 |
| Molecular Formula | C20H15Br3N4O |
| Molecular Weight | 567.08 g/mol |
| Exact Mass | 563.88 |
| IUPAC Name | 3-bromo-7-(2-ethoxyethenyl)-1,5-naphthyridine;3,7-dibromo-1,5-naphthyridine |
| SMILES | Brc1cnc2cc(Br)cnc2c1.CCOC=Cc1cnc2cc(Br)cnc2c1 |
| InChI | InChI=1S/C12H11BrN2O.C8H4Br2N2/c1-2-16-4-3-9-5-11-12(14-7-9)6-10(13)8-15-11;9-5-1-7-8(12-3-5)2-6(10)4-11-7/h3-8H,2H2,1H3;1-4H |
| InChIKey | HMGPEAQKRZVXKA-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.08 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|