C23H19NO4S — CID 158521584
(5Z)-3-[3-(4-methylphenyl)-2-oxopropyl]-5-[(4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 158521584) has the molecular formula C23H19NO4S and a molecular weight of 405.48 g/mol. Its IUPAC name is (5Z)-3-[3-(4-methylphenyl)-2-oxopropyl]-5-[(4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[3-(4-methylphenyl)-2-oxopropyl]-5-[(4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 158521584 |
| Molecular Formula | C23H19NO4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (5Z)-3-[3-(4-methylphenyl)-2-oxopropyl]-5-[(4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C#CCOc1ccc(/C=C2\SC(=O)N(CC(=O)Cc3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H19NO4S/c1-3-12-28-20-10-8-18(9-11-20)14-21-22(26)24(23(27)29-21)15-19(25)13-17-6-4-16(2)5-7-17/h1,4-11,14H,12-13,15H2,2H3/b21-14- |
| InChIKey | NUMRGEAAQNKEBL-STZFKDTASA-N |
| XLogP | 3.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|