About benzene;cycloocta-1,5-diene;rhodium
benzene;cycloocta-1,5-diene;rhodium (PubChem CID 158521667) has the molecular formula C14H18Rh
and a molecular weight of 289.20 g/mol. Its IUPAC name is benzene;cycloocta-1,5-diene;rhodium.
Molecular Properties
| Compound Name | benzene;cycloocta-1,5-diene;rhodium |
| PubChem CID | 158521667 |
| Molecular Formula | C14H18Rh |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | benzene;cycloocta-1,5-diene;rhodium |
| SMILES | C1=CCCC=CCC1.[Rh].c1ccccc1 |
| InChI | InChI=1S/C8H12.C6H6.Rh/c1-2-4-6-8-7-5-3-1;1-2-4-6-5-3-1;/h1-2,7-8H,3-6H2;1-6H; |
| InChIKey | HMHFSBLPBQMMCO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzene;cycloocta-1,5-diene;rhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;cycloocta-1,5-diene;rhodium?
The IUPAC name of benzene;cycloocta-1,5-diene;rhodium (CID 158521667) is benzene;cycloocta-1,5-diene;rhodium.
What is the SMILES notation for benzene;cycloocta-1,5-diene;rhodium?
The canonical SMILES for benzene;cycloocta-1,5-diene;rhodium is C1=CCCC=CCC1.[Rh].c1ccccc1.
What is the InChIKey of benzene;cycloocta-1,5-diene;rhodium?
The InChIKey is HMHFSBLPBQMMCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12.C6H6.Rh/c1-2-4-6-8-7-5-3-1;1-2-4-6-5-3-1;/h1-2,7-8H,3-6H2;1-6H;.
What are the key properties of benzene;cycloocta-1,5-diene;rhodium?
benzene;cycloocta-1,5-diene;rhodium has a molecular weight of 289.20 g/mol, XLogP of 4.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;cycloocta-1,5-diene;rhodium is sourced from PubChem (CID 158521667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).