C14H18Ru — CID 173055648
benzene;(5Z)-cycloocta-1,5-diene;ruthenium (PubChem CID 173055648) has the molecular formula C14H18Ru and a molecular weight of 287.37 g/mol. Its IUPAC name is benzene;(5Z)-cycloocta-1,5-diene;ruthenium.
| Compound Name | benzene;(5Z)-cycloocta-1,5-diene;ruthenium |
|---|---|
| PubChem CID | 173055648 |
| Molecular Formula | C14H18Ru |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | benzene;(5Z)-cycloocta-1,5-diene;ruthenium |
| SMILES | C1=CCC/C=C\CC1.[Ru].c1ccccc1 |
| InChI | InChI=1S/C8H12.C6H6.Ru/c1-2-4-6-8-7-5-3-1;1-2-4-6-5-3-1;/h1-2,7-8H,3-6H2;1-6H;/b2-1-,8-7?;; |
| InChIKey | ZLFZRTSZGXXNQN-RPMSXJIWSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|