C26H23FN4O2 — CID 158522541
2-[[[1-(7-fluoroisoquinolin-1-yl)pyrrolidin-2-yl]methylamino]methyl]-1H-chromeno[4,3-b]pyrrol-4-one (PubChem CID 158522541) has the molecular formula C26H23FN4O2 and a molecular weight of 442.49 g/mol. Its IUPAC name is 2-[[[1-(7-fluoroisoquinolin-1-yl)pyrrolidin-2-yl]methylamino]methyl]-1H-chromeno[4,3-b]pyrrol-4-one.
| Compound Name | 2-[[[1-(7-fluoroisoquinolin-1-yl)pyrrolidin-2-yl]methylamino]methyl]-1H-chromeno[4,3-b]pyrrol-4-one |
|---|---|
| PubChem CID | 158522541 |
| Molecular Formula | C26H23FN4O2 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 2-[[[1-(7-fluoroisoquinolin-1-yl)pyrrolidin-2-yl]methylamino]methyl]-1H-chromeno[4,3-b]pyrrol-4-one |
| SMILES | O=c1oc2ccccc2c2[nH]c(CNCC3CCCN3c3nccc4ccc(F)cc34)cc12 |
| InChI | InChI=1S/C26H23FN4O2/c27-17-8-7-16-9-10-29-25(21(16)12-17)31-11-3-4-19(31)15-28-14-18-13-22-24(30-18)20-5-1-2-6-23(20)33-26(22)32/h1-2,5-10,12-13,19,28,30H,3-4,11,14-15H2 |
| InChIKey | HMJTXUHVPOAEMA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|