C27H25FN4O3 — CID 121429872
2-[[[1-(7-fluoroisoquinolin-1-yl)-3-methoxypiperidin-4-yl]amino]methyl]-1H-chromeno[4,3-b]pyrrol-4-one (PubChem CID 121429872) has the molecular formula C27H25FN4O3 and a molecular weight of 472.52 g/mol. Its IUPAC name is 2-[[[1-(7-fluoroisoquinolin-1-yl)-3-methoxypiperidin-4-yl]amino]methyl]-1H-chromeno[4,3-b]pyrrol-4-one.
| Compound Name | 2-[[[1-(7-fluoroisoquinolin-1-yl)-3-methoxypiperidin-4-yl]amino]methyl]-1H-chromeno[4,3-b]pyrrol-4-one |
|---|---|
| PubChem CID | 121429872 |
| Molecular Formula | C27H25FN4O3 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 2-[[[1-(7-fluoroisoquinolin-1-yl)-3-methoxypiperidin-4-yl]amino]methyl]-1H-chromeno[4,3-b]pyrrol-4-one |
| SMILES | COC1CN(c2nccc3ccc(F)cc23)CCC1NCc1cc2c(=O)oc3ccccc3c2[nH]1 |
| InChI | InChI=1S/C27H25FN4O3/c1-34-24-15-32(26-20-12-17(28)7-6-16(20)8-10-29-26)11-9-22(24)30-14-18-13-21-25(31-18)19-4-2-3-5-23(19)35-27(21)33/h2-8,10,12-13,22,24,30-31H,9,11,14-15H2,1H3 |
| InChIKey | RFXPWDBEPOSSQK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|