C18H19FN2O2 — CID 121433037
methyl (Z)-3-[1-(7-fluoroisoquinolin-1-yl)piperidin-4-yl]prop-2-enoate (PubChem CID 121433037) has the molecular formula C18H19FN2O2 and a molecular weight of 314.36 g/mol. Its IUPAC name is methyl (Z)-3-[1-(7-fluoroisoquinolin-1-yl)piperidin-4-yl]prop-2-enoate.
| Compound Name | methyl (Z)-3-[1-(7-fluoroisoquinolin-1-yl)piperidin-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 121433037 |
| Molecular Formula | C18H19FN2O2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | methyl (Z)-3-[1-(7-fluoroisoquinolin-1-yl)piperidin-4-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C\C1CCN(c2nccc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C18H19FN2O2/c1-23-17(22)5-2-13-7-10-21(11-8-13)18-16-12-15(19)4-3-14(16)6-9-20-18/h2-6,9,12-13H,7-8,10-11H2,1H3/b5-2- |
| InChIKey | UCLSGWYBAPRAED-DJWKRKHSSA-N |
| XLogP | 3.32 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|