C25H24F2N4O2 — CID 121415524
6-fluoro-4-[2-[[1-(7-fluoroisoquinolin-1-yl)piperidin-4-yl]amino]ethylamino]chromen-2-one (PubChem CID 121415524) has the molecular formula C25H24F2N4O2 and a molecular weight of 450.49 g/mol. Its IUPAC name is 6-fluoro-4-[2-[[1-(7-fluoroisoquinolin-1-yl)piperidin-4-yl]amino]ethylamino]chromen-2-one.
| Compound Name | 6-fluoro-4-[2-[[1-(7-fluoroisoquinolin-1-yl)piperidin-4-yl]amino]ethylamino]chromen-2-one |
|---|---|
| PubChem CID | 121415524 |
| Molecular Formula | C25H24F2N4O2 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 6-fluoro-4-[2-[[1-(7-fluoroisoquinolin-1-yl)piperidin-4-yl]amino]ethylamino]chromen-2-one |
| SMILES | O=c1cc(NCCNC2CCN(c3nccc4ccc(F)cc34)CC2)c2cc(F)ccc2o1 |
| InChI | InChI=1S/C25H24F2N4O2/c26-17-2-1-16-5-8-30-25(20(16)13-17)31-11-6-19(7-12-31)28-9-10-29-22-15-24(32)33-23-4-3-18(27)14-21(22)23/h1-5,8,13-15,19,28-29H,6-7,9-12H2 |
| InChIKey | CMWBNJCMFKOWLQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|