C30H27Cl5O5 — CID 158526476
(4-chlorophenyl)-(3,4-dimethoxyphenyl)methanone;1-chloro-4-(trichloromethyl)benzene;1,2-dimethoxybenzene (PubChem CID 158526476) has the molecular formula C30H27Cl5O5 and a molecular weight of 644.81 g/mol. Its IUPAC name is (4-chlorophenyl)-(3,4-dimethoxyphenyl)methanone;1-chloro-4-(trichloromethyl)benzene;1,2-dimethoxybenzene.
| Compound Name | (4-chlorophenyl)-(3,4-dimethoxyphenyl)methanone;1-chloro-4-(trichloromethyl)benzene;1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 158526476 |
| Molecular Formula | C30H27Cl5O5 |
| Molecular Weight | 644.81 g/mol |
| Exact Mass | 642.03 |
| IUPAC Name | (4-chlorophenyl)-(3,4-dimethoxyphenyl)methanone;1-chloro-4-(trichloromethyl)benzene;1,2-dimethoxybenzene |
| SMILES | COc1ccc(C(=O)c2ccc(Cl)cc2)cc1OC.COc1ccccc1OC.Clc1ccc(C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C15H13ClO3.C8H10O2.C7H4Cl4/c1-18-13-8-5-11(9-14(13)19-2)15(17)10-3-6-12(16)7-4-10;1-9-7-5-3-4-6-8(7)10-2;8-6-3-1-5(2-4-6)7(9,10)11/h3-9H,1-2H3;3-6H,1-2H3;1-4H |
| InChIKey | HMVQLIRNPYRDBI-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.81 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|