C36H38N6O2 — CID 158527857
4-[4-(6-methyl-3H-isoindol-1-yl)-2-pyridinyl]morpholine (PubChem CID 158527857) has the molecular formula C36H38N6O2 and a molecular weight of 586.74 g/mol. Its IUPAC name is 4-[4-(6-methyl-3H-isoindol-1-yl)-2-pyridinyl]morpholine.
| Compound Name | 4-[4-(6-methyl-3H-isoindol-1-yl)-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 158527857 |
| Molecular Formula | C36H38N6O2 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | 4-[4-(6-methyl-3H-isoindol-1-yl)-2-pyridinyl]morpholine |
| SMILES | Cc1ccc2c(c1)C(c1ccnc(N3CCOCC3)c1)=NC2.Cc1ccc2c(c1)C(c1ccnc(N3CCOCC3)c1)=NC2 |
| InChI | InChI=1S/2C18H19N3O/c2*1-13-2-3-15-12-20-18(16(15)10-13)14-4-5-19-17(11-14)21-6-8-22-9-7-21/h2*2-5,10-11H,6-9,12H2,1H3 |
| InChIKey | HMZRNSHGFDOFRQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 75.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |