C28H29Cl2N5O3 — CID 158528811
3-(4-acetylcyclohexyl)imino-2-(aminomethylidene)-N-[2-(3,5-dichloro-4-pyridinyl)-2-oxoethyl]-N-[(2-isocyanophenyl)methyl]butanamide (PubChem CID 158528811) has the molecular formula C28H29Cl2N5O3 and a molecular weight of 554.48 g/mol. Its IUPAC name is 3-(4-acetylcyclohexyl)imino-2-(aminomethylidene)-N-[2-(3,5-dichloro-4-pyridinyl)-2-oxoethyl]-N-[(2-isocyanophenyl)methyl]butanamide.
| Compound Name | 3-(4-acetylcyclohexyl)imino-2-(aminomethylidene)-N-[2-(3,5-dichloro-4-pyridinyl)-2-oxoethyl]-N-[(2-isocyanophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 158528811 |
| Molecular Formula | C28H29Cl2N5O3 |
| Molecular Weight | 554.48 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | 3-(4-acetylcyclohexyl)imino-2-(aminomethylidene)-N-[2-(3,5-dichloro-4-pyridinyl)-2-oxoethyl]-N-[(2-isocyanophenyl)methyl]butanamide |
| SMILES | [C-]#[N+]c1ccccc1CN(CC(=O)c1c(Cl)cncc1Cl)C(=O)C(=CN)/C(C)=N/C1CCC(C(C)=O)CC1 |
| InChI | InChI=1S/C28H29Cl2N5O3/c1-17(34-21-10-8-19(9-11-21)18(2)36)22(12-31)28(38)35(15-20-6-4-5-7-25(20)32-3)16-26(37)27-23(29)13-33-14-24(27)30/h4-7,12-14,19,21H,8-11,15-16,31H2,1-2H3/b22-12?,34-17+ |
| InChIKey | PGVFAJZBGUTWLG-NQPMOWFZSA-N |
| XLogP | 5.60 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|