C53H42BNS2 — CID 158531763
3-(5,17-ditert-butyl-8,14-dithia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl)-5-(10-phenylanthracen-9-yl)benzonitrile (PubChem CID 158531763) has the molecular formula C53H42BNS2 and a molecular weight of 767.87 g/mol. Its IUPAC name is 3-(5,17-ditert-butyl-8,14-dithia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl)-5-(10-phenylanthracen-9-yl)benzonitrile.
| Compound Name | 3-(5,17-ditert-butyl-8,14-dithia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl)-5-(10-phenylanthracen-9-yl)benzonitrile |
|---|---|
| PubChem CID | 158531763 |
| Molecular Formula | C53H42BNS2 |
| Molecular Weight | 767.87 g/mol |
| Exact Mass | 767.29 |
| IUPAC Name | 3-(5,17-ditert-butyl-8,14-dithia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl)-5-(10-phenylanthracen-9-yl)benzonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)Sc1cc(-c3cc(C#N)cc(-c4c5ccccc5c(-c5ccccc5)c5ccccc45)c3)cc3c1B2c1ccc(C(C)(C)C)cc1S3 |
| InChI | InChI=1S/C53H42BNS2/c1-52(2,3)37-20-22-43-45(29-37)56-47-27-35(28-48-51(47)54(43)44-23-21-38(53(4,5)6)30-46(44)57-48)34-24-32(31-55)25-36(26-34)50-41-18-12-10-16-39(41)49(33-14-8-7-9-15-33)40-17-11-13-19-42(40)50/h7-30H,1-6H3 |
| InChIKey | GENXBOUKGWSKAU-UHFFFAOYSA-N |
| XLogP | 12.91 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.87 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|