C46H39BS2 — CID 159566110
4,18-ditert-butyl-11-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-8,14-dithia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 159566110) has the molecular formula C46H39BS2 and a molecular weight of 671.79 g/mol. Its IUPAC name is 4,18-ditert-butyl-11-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-8,14-dithia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 4,18-ditert-butyl-11-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-8,14-dithia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 159566110 |
| Molecular Formula | C46H39BS2 |
| Molecular Weight | 671.79 g/mol |
| Exact Mass | 671.29 |
| IUPAC Name | 4,18-ditert-butyl-11-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-8,14-dithia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccccc3c(-c3cc4c5c(c3)Sc3ccc(C(C)(C)C)cc3B5c3cc(C(C)(C)C)ccc3S4)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C46H39BS2/c1-45(2,3)30-20-22-38-36(26-30)47-37-27-31(46(4,5)6)21-23-39(37)49-41-25-29(24-40(48-38)44(41)47)43-34-18-12-10-16-32(34)42(28-14-8-7-9-15-28)33-17-11-13-19-35(33)43/h7-27H,1-6H3/i7D,8D,9D,14D,15D |
| InChIKey | MZMOOQJPLHYKJK-CFPNEJFESA-N |
| XLogP | 11.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.79 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|