C31H28BFN2S — CID 162427996
16,23-ditert-butyl-11-fluoro-19-thia-12,13-diaza-1-boraheptacyclo[12.11.1.12,10.04,9.018,26.020,25.013,27]heptacosa-2,4,6,8,10(27),11,14(26),15,17,20(25),21,23-dodecaene (PubChem CID 162427996) has the molecular formula C31H28BFN2S and a molecular weight of 490.46 g/mol. Its IUPAC name is 16,23-ditert-butyl-11-fluoro-19-thia-12,13-diaza-1-boraheptacyclo[12.11.1.12,10.04,9.018,26.020,25.013,27]heptacosa-2,4,6,8,10(27),11,14(26),15,17,20(25),21,23-dodecaene.
| Compound Name | 16,23-ditert-butyl-11-fluoro-19-thia-12,13-diaza-1-boraheptacyclo[12.11.1.12,10.04,9.018,26.020,25.013,27]heptacosa-2,4,6,8,10(27),11,14(26),15,17,20(25),21,23-dodecaene |
|---|---|
| PubChem CID | 162427996 |
| Molecular Formula | C31H28BFN2S |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 16,23-ditert-butyl-11-fluoro-19-thia-12,13-diaza-1-boraheptacyclo[12.11.1.12,10.04,9.018,26.020,25.013,27]heptacosa-2,4,6,8,10(27),11,14(26),15,17,20(25),21,23-dodecaene |
| SMILES | CC(C)(C)c1ccc2c(c1)B1c3c(cc(C(C)(C)C)cc3-n3nc(F)c4c5ccccc5cc1c43)S2 |
| InChI | InChI=1S/C31H28BFN2S/c1-30(2,3)18-11-12-24-21(14-18)32-22-13-17-9-7-8-10-20(17)26-28(22)35(34-29(26)33)23-15-19(31(4,5)6)16-25(36-24)27(23)32/h7-16H,1-6H3 |
| InChIKey | XUAFZTXLZJHFGA-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|