C38H28BN3S — CID 174034918
24-tert-butyl-6,11-dipyridin-3-yl-21-thia-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3(8),4,6,9(27),10,12,15,17,19,22,24-dodecaene (PubChem CID 174034918) has the molecular formula C38H28BN3S and a molecular weight of 569.54 g/mol. Its IUPAC name is 24-tert-butyl-6,11-dipyridin-3-yl-21-thia-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3(8),4,6,9(27),10,12,15,17,19,22,24-dodecaene.
| Compound Name | 24-tert-butyl-6,11-dipyridin-3-yl-21-thia-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3(8),4,6,9(27),10,12,15,17,19,22,24-dodecaene |
|---|---|
| PubChem CID | 174034918 |
| Molecular Formula | C38H28BN3S |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | 24-tert-butyl-6,11-dipyridin-3-yl-21-thia-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3(8),4,6,9(27),10,12,15,17,19,22,24-dodecaene |
| SMILES | CC(C)(C)c1cc2c3c(c1)-n1c4ccc(-c5cccnc5)cc4c4cc(-c5cccnc5)cc(c41)B3c1ccccc1S2 |
| InChI | InChI=1S/C38H28BN3S/c1-38(2,3)27-19-33-36-35(20-27)43-34-11-5-4-10-30(34)39(36)31-18-26(25-9-7-15-41-22-25)17-29-28-16-23(24-8-6-14-40-21-24)12-13-32(28)42(33)37(29)31/h4-22H,1-3H3 |
| InChIKey | ZIAJFNTVAZNIOZ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|