C32H29BBrNS — CID 164675943
24-bromo-6,11-ditert-butyl-21-thia-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3(8),4,6,9(27),10,12,15,17,19,22,24-dodecaene (PubChem CID 164675943) has the molecular formula C32H29BBrNS and a molecular weight of 550.37 g/mol. Its IUPAC name is 24-bromo-6,11-ditert-butyl-21-thia-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3(8),4,6,9(27),10,12,15,17,19,22,24-dodecaene.
| Compound Name | 24-bromo-6,11-ditert-butyl-21-thia-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3(8),4,6,9(27),10,12,15,17,19,22,24-dodecaene |
|---|---|
| PubChem CID | 164675943 |
| Molecular Formula | C32H29BBrNS |
| Molecular Weight | 550.37 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | 24-bromo-6,11-ditert-butyl-21-thia-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3(8),4,6,9(27),10,12,15,17,19,22,24-dodecaene |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)cc3c1n2-c1cc(Br)cc2c1B3c1ccccc1S2 |
| InChI | InChI=1S/C32H29BBrNS/c1-31(2,3)18-11-12-25-21(13-18)22-14-19(32(4,5)6)15-24-30(22)35(25)26-16-20(34)17-28-29(26)33(24)23-9-7-8-10-27(23)36-28/h7-17H,1-6H3 |
| InChIKey | HGQQVPLWGJBFHX-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.37 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|