C43H31BN4S — CID 174034948
24-tert-butyl-11-(4,6-diphenyl-1,3,5-triazin-2-yl)-21-thia-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3,5,7,9(27),10,12,15,17,19,22,24-dodecaene (PubChem CID 174034948) has the molecular formula C43H31BN4S and a molecular weight of 646.63 g/mol. Its IUPAC name is 24-tert-butyl-11-(4,6-diphenyl-1,3,5-triazin-2-yl)-21-thia-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3,5,7,9(27),10,12,15,17,19,22,24-dodecaene.
| Compound Name | 24-tert-butyl-11-(4,6-diphenyl-1,3,5-triazin-2-yl)-21-thia-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3,5,7,9(27),10,12,15,17,19,22,24-dodecaene |
|---|---|
| PubChem CID | 174034948 |
| Molecular Formula | C43H31BN4S |
| Molecular Weight | 646.63 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | 24-tert-butyl-11-(4,6-diphenyl-1,3,5-triazin-2-yl)-21-thia-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3,5,7,9(27),10,12,15,17,19,22,24-dodecaene |
| SMILES | CC(C)(C)c1cc2c3c(c1)-n1c4ccccc4c4cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc(c41)B3c1ccccc1S2 |
| InChI | InChI=1S/C43H31BN4S/c1-43(2,3)29-24-35-38-37(25-29)49-36-21-13-11-19-32(36)44(38)33-23-28(22-31-30-18-10-12-20-34(30)48(35)39(31)33)42-46-40(26-14-6-4-7-15-26)45-41(47-42)27-16-8-5-9-17-27/h4-25H,1-3H3 |
| InChIKey | XIKGSYQIGUYWGI-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.63 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|