C32H35BN4 — CID 168741847
7,12,17-tritert-butyl-8,9,15,16-tetraza-1-boraheptacyclo[12.8.1.12,6.115,18.010,23.09,25.022,24]pentacosa-2(25),3,5,7,10,12,14(23),16,18,20,22(24)-undecaene (PubChem CID 168741847) has the molecular formula C32H35BN4 and a molecular weight of 486.47 g/mol. Its IUPAC name is 7,12,17-tritert-butyl-8,9,15,16-tetraza-1-boraheptacyclo[12.8.1.12,6.115,18.010,23.09,25.022,24]pentacosa-2(25),3,5,7,10,12,14(23),16,18,20,22(24)-undecaene.
| Compound Name | 7,12,17-tritert-butyl-8,9,15,16-tetraza-1-boraheptacyclo[12.8.1.12,6.115,18.010,23.09,25.022,24]pentacosa-2(25),3,5,7,10,12,14(23),16,18,20,22(24)-undecaene |
|---|---|
| PubChem CID | 168741847 |
| Molecular Formula | C32H35BN4 |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 7,12,17-tritert-butyl-8,9,15,16-tetraza-1-boraheptacyclo[12.8.1.12,6.115,18.010,23.09,25.022,24]pentacosa-2(25),3,5,7,10,12,14(23),16,18,20,22(24)-undecaene |
| SMILES | CC(C)(C)c1cc2c3c(c1)-n1nc(C(C)(C)C)c4cccc(c41)B3c1cccc3c(C(C)(C)C)nn-2c13 |
| InChI | InChI=1S/C32H35BN4/c1-30(2,3)18-16-23-25-24(17-18)37-27-20(29(35-37)32(7,8)9)13-11-15-22(27)33(25)21-14-10-12-19-26(21)36(23)34-28(19)31(4,5)6/h10-17H,1-9H3 |
| InChIKey | OBSWCDWCRYIXPT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|