C40H34BN5 — CID 163711428
4,20-ditert-butyl-12-carbazol-9-yl-7,9,15,17-tetraza-1-boraheptacyclo[12.8.1.12,6.115,18.010,23.09,25.022,24]pentacosa-2,4,6(25),7,10,12,14(23),16,18(24),19,21-undecaene (PubChem CID 163711428) has the molecular formula C40H34BN5 and a molecular weight of 595.56 g/mol. Its IUPAC name is 4,20-ditert-butyl-12-carbazol-9-yl-7,9,15,17-tetraza-1-boraheptacyclo[12.8.1.12,6.115,18.010,23.09,25.022,24]pentacosa-2,4,6(25),7,10,12,14(23),16,18(24),19,21-undecaene.
| Compound Name | 4,20-ditert-butyl-12-carbazol-9-yl-7,9,15,17-tetraza-1-boraheptacyclo[12.8.1.12,6.115,18.010,23.09,25.022,24]pentacosa-2,4,6(25),7,10,12,14(23),16,18(24),19,21-undecaene |
|---|---|
| PubChem CID | 163711428 |
| Molecular Formula | C40H34BN5 |
| Molecular Weight | 595.56 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | 4,20-ditert-butyl-12-carbazol-9-yl-7,9,15,17-tetraza-1-boraheptacyclo[12.8.1.12,6.115,18.010,23.09,25.022,24]pentacosa-2,4,6(25),7,10,12,14(23),16,18(24),19,21-undecaene |
| SMILES | CC(C)(C)c1cc2c3c(c1)ncn3-c1cc(-n3c4ccccc4c4ccccc43)cc3c1B2c1cc(C(C)(C)C)cc2ncn-3c12 |
| InChI | InChI=1S/C40H34BN5/c1-39(2,3)23-15-28-37-30(17-23)42-21-44(37)34-19-25(46-32-13-9-7-11-26(32)27-12-8-10-14-33(27)46)20-35-36(34)41(28)29-16-24(40(4,5)6)18-31-38(29)45(35)22-43-31/h7-22H,1-6H3 |
| InChIKey | LGIRGSRTGSTZIG-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 40.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.56 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|