C40H64N2O6Si — CID 158535556
N-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-2-oxoheptanamide;N-(5-hydroxypentyl)-2-oxoheptanamide (PubChem CID 158535556) has the molecular formula C40H64N2O6Si and a molecular weight of 697.05 g/mol. Its IUPAC name is N-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-2-oxoheptanamide;N-(5-hydroxypentyl)-2-oxoheptanamide.
| Compound Name | N-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-2-oxoheptanamide;N-(5-hydroxypentyl)-2-oxoheptanamide |
|---|---|
| PubChem CID | 158535556 |
| Molecular Formula | C40H64N2O6Si |
| Molecular Weight | 697.05 g/mol |
| Exact Mass | 696.45 |
| IUPAC Name | N-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-2-oxoheptanamide;N-(5-hydroxypentyl)-2-oxoheptanamide |
| SMILES | CCCCCC(=O)C(=O)NCCCCCO.CCCCCC(=O)C(=O)NCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H41NO3Si.C12H23NO3/c1-5-6-10-21-26(30)27(31)29-22-15-9-16-23-32-33(28(2,3)4,24-17-11-7-12-18-24)25-19-13-8-14-20-25;1-2-3-5-8-11(15)12(16)13-9-6-4-7-10-14/h7-8,11-14,17-20H,5-6,9-10,15-16,21-23H2,1-4H3,(H,29,31);14H,2-10H2,1H3,(H,13,16) |
| InChIKey | HNXBSPPXPNDXMK-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.05 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|