About but-1-ene;4-propyl-4-(trimethoxymethyl)dodecane
but-1-ene;4-propyl-4-(trimethoxymethyl)dodecane (PubChem CID 158535756) has the molecular formula C23H48O3
and a molecular weight of 372.63 g/mol. Its IUPAC name is but-1-ene;4-propyl-4-(trimethoxymethyl)dodecane.
Molecular Properties
| Compound Name | but-1-ene;4-propyl-4-(trimethoxymethyl)dodecane |
| PubChem CID | 158535756 |
| Molecular Formula | C23H48O3 |
| Molecular Weight | 372.63 g/mol |
| Exact Mass | 372.36 |
| IUPAC Name | but-1-ene;4-propyl-4-(trimethoxymethyl)dodecane |
| SMILES | C=CCC.CCCCCCCCC(CCC)(CCC)C(OC)(OC)OC |
| InChI | InChI=1S/C19H40O3.C4H8/c1-7-10-11-12-13-14-17-18(15-8-2,16-9-3)19(20-4,21-5)22-6;1-3-4-2/h7-17H2,1-6H3;3H,1,4H2,2H3 |
| InChIKey | HNXRLFDKPVIRCB-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.63 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;4-propyl-4-(trimethoxymethyl)dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;4-propyl-4-(trimethoxymethyl)dodecane?
The IUPAC name of but-1-ene;4-propyl-4-(trimethoxymethyl)dodecane (CID 158535756) is but-1-ene;4-propyl-4-(trimethoxymethyl)dodecane.
What is the SMILES notation for but-1-ene;4-propyl-4-(trimethoxymethyl)dodecane?
The canonical SMILES for but-1-ene;4-propyl-4-(trimethoxymethyl)dodecane is C=CCC.CCCCCCCCC(CCC)(CCC)C(OC)(OC)OC.
What is the InChIKey of but-1-ene;4-propyl-4-(trimethoxymethyl)dodecane?
The InChIKey is HNXRLFDKPVIRCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40O3.C4H8/c1-7-10-11-12-13-14-17-18(15-8-2,16-9-3)19(20-4,21-5)22-6;1-3-4-2/h7-17H2,1-6H3;3H,1,4H2,2H3.
What are the key properties of but-1-ene;4-propyl-4-(trimethoxymethyl)dodecane?
but-1-ene;4-propyl-4-(trimethoxymethyl)dodecane has a molecular weight of 372.63 g/mol, XLogP of 7.50, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;4-propyl-4-(trimethoxymethyl)dodecane is sourced from PubChem (CID 158535756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).