C22H25F3N6O4 — CID 158536694
6-(2,2,2-trifluoroethoxy)-16,19,22-trioxa-3,5,7,12,13,29-hexazatetracyclo[21.2.2.14,8.110,13]nonacosa-1(26),4,6,8(29),10(28),11,23(27),24-octaene (PubChem CID 158536694) has the molecular formula C22H25F3N6O4 and a molecular weight of 494.47 g/mol. Its IUPAC name is 6-(2,2,2-trifluoroethoxy)-16,19,22-trioxa-3,5,7,12,13,29-hexazatetracyclo[21.2.2.14,8.110,13]nonacosa-1(26),4,6,8(29),10(28),11,23(27),24-octaene.
| Compound Name | 6-(2,2,2-trifluoroethoxy)-16,19,22-trioxa-3,5,7,12,13,29-hexazatetracyclo[21.2.2.14,8.110,13]nonacosa-1(26),4,6,8(29),10(28),11,23(27),24-octaene |
|---|---|
| PubChem CID | 158536694 |
| Molecular Formula | C22H25F3N6O4 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 6-(2,2,2-trifluoroethoxy)-16,19,22-trioxa-3,5,7,12,13,29-hexazatetracyclo[21.2.2.14,8.110,13]nonacosa-1(26),4,6,8(29),10(28),11,23(27),24-octaene |
| SMILES | FC(F)(F)COc1nc2nc(n1)NCc1ccc(cc1)OCCOCCOCCn1cc(cn1)C2 |
| InChI | InChI=1S/C22H25F3N6O4/c23-22(24,25)15-35-21-29-19-11-17-13-27-31(14-17)5-6-32-7-8-33-9-10-34-18-3-1-16(2-4-18)12-26-20(28-19)30-21/h1-4,13-14H,5-12,15H2,(H,26,28,29,30) |
| InChIKey | HOAJYLHDLZABGB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|