C15H9BrF2N4OS — CID 158537421
N-[3-(3-bromo-2,6-difluorophenyl)-1,2,4-thiadiazol-5-yl]-2-methylpyridine-3-carboxamide (PubChem CID 158537421) has the molecular formula C15H9BrF2N4OS and a molecular weight of 411.23 g/mol. Its IUPAC name is N-[3-(3-bromo-2,6-difluorophenyl)-1,2,4-thiadiazol-5-yl]-2-methylpyridine-3-carboxamide.
| Compound Name | N-[3-(3-bromo-2,6-difluorophenyl)-1,2,4-thiadiazol-5-yl]-2-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 158537421 |
| Molecular Formula | C15H9BrF2N4OS |
| Molecular Weight | 411.23 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | N-[3-(3-bromo-2,6-difluorophenyl)-1,2,4-thiadiazol-5-yl]-2-methylpyridine-3-carboxamide |
| SMILES | Cc1ncccc1C(=O)Nc1nc(-c2c(F)ccc(Br)c2F)ns1 |
| InChI | InChI=1S/C15H9BrF2N4OS/c1-7-8(3-2-6-19-7)14(23)21-15-20-13(22-24-15)11-10(17)5-4-9(16)12(11)18/h2-6H,1H3,(H,20,21,22,23) |
| InChIKey | LDVUPSZADDLPOG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|