C15H24N2O — CID 15853905
trans-(1S,2S)-2-(3-cyclohexylpyrazol-1-yl)cyclohexan-1-ol (PubChem CID 15853905) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is trans-(1S,2S)-2-(3-cyclohexylpyrazol-1-yl)cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-(3-cyclohexylpyrazol-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 15853905 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | trans-(1S,2S)-2-(3-cyclohexylpyrazol-1-yl)cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1n1ccc(C2CCCCC2)n1 |
| InChI | InChI=1S/C15H24N2O/c18-15-9-5-4-8-14(15)17-11-10-13(16-17)12-6-2-1-3-7-12/h10-12,14-15,18H,1-9H2/t14-,15-/m0/s1 |
| InChIKey | UFYIOMUOPXRNEN-GJZGRUSLSA-N |
| XLogP | 3.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |