C32H25N5 — CID 158539257
3-[1-[3-(4-methyl-2-pyridinyl)phenyl]triazol-4-yl]-N,N-diphenylaniline (PubChem CID 158539257) has the molecular formula C32H25N5 and a molecular weight of 479.59 g/mol. Its IUPAC name is 3-[1-[3-(4-methyl-2-pyridinyl)phenyl]triazol-4-yl]-N,N-diphenylaniline.
| Compound Name | 3-[1-[3-(4-methyl-2-pyridinyl)phenyl]triazol-4-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 158539257 |
| Molecular Formula | C32H25N5 |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 3-[1-[3-(4-methyl-2-pyridinyl)phenyl]triazol-4-yl]-N,N-diphenylaniline |
| SMILES | Cc1ccnc(-c2cccc(-n3cc(-c4cccc(N(c5ccccc5)c5ccccc5)c4)nn3)c2)c1 |
| InChI | InChI=1S/C32H25N5/c1-24-18-19-33-31(20-24)25-10-8-16-29(21-25)36-23-32(34-35-36)26-11-9-17-30(22-26)37(27-12-4-2-5-13-27)28-14-6-3-7-15-28/h2-23H,1H3 |
| InChIKey | LMKDIEADZJZAGQ-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |