C40H33N3 — CID 156870710
3-(4-methyl-2-pyridinyl)-N-[3-[4-[(3E)-penta-1,3-dien-3-yl]-2-pyridinyl]phenyl]-N-(4-phenylphenyl)aniline (PubChem CID 156870710) has the molecular formula C40H33N3 and a molecular weight of 555.73 g/mol. Its IUPAC name is 3-(4-methyl-2-pyridinyl)-N-[3-[4-[(3E)-penta-1,3-dien-3-yl]-2-pyridinyl]phenyl]-N-(4-phenylphenyl)aniline.
| Compound Name | 3-(4-methyl-2-pyridinyl)-N-[3-[4-[(3E)-penta-1,3-dien-3-yl]-2-pyridinyl]phenyl]-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 156870710 |
| Molecular Formula | C40H33N3 |
| Molecular Weight | 555.73 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | 3-(4-methyl-2-pyridinyl)-N-[3-[4-[(3E)-penta-1,3-dien-3-yl]-2-pyridinyl]phenyl]-N-(4-phenylphenyl)aniline |
| SMILES | C=C/C(=C\C)c1ccnc(-c2cccc(N(c3ccc(-c4ccccc4)cc3)c3cccc(-c4cc(C)ccn4)c3)c2)c1 |
| InChI | InChI=1S/C40H33N3/c1-4-30(5-2)33-22-24-42-40(28-33)35-14-10-16-38(27-35)43(36-19-17-32(18-20-36)31-11-7-6-8-12-31)37-15-9-13-34(26-37)39-25-29(3)21-23-41-39/h4-28H,1H2,2-3H3/b30-5+ |
| InChIKey | AXHXSWPYJYRRSG-NZRVNVCISA-N |
| XLogP | 10.85 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.73 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|