C21H43NO8 — CID 158540782
tert-butyl 2-(2,2-dimethylpropyl)-6-(1,2,3,4,5,6-hexahydroxyhexylamino)hexanoate (PubChem CID 158540782) has the molecular formula C21H43NO8 and a molecular weight of 437.57 g/mol. Its IUPAC name is tert-butyl 2-(2,2-dimethylpropyl)-6-(1,2,3,4,5,6-hexahydroxyhexylamino)hexanoate.
| Compound Name | tert-butyl 2-(2,2-dimethylpropyl)-6-(1,2,3,4,5,6-hexahydroxyhexylamino)hexanoate |
|---|---|
| PubChem CID | 158540782 |
| Molecular Formula | C21H43NO8 |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | tert-butyl 2-(2,2-dimethylpropyl)-6-(1,2,3,4,5,6-hexahydroxyhexylamino)hexanoate |
| SMILES | CC(C)(C)CC(CCCCNC(O)C(O)C(O)C(O)C(O)CO)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H43NO8/c1-20(2,3)11-13(19(29)30-21(4,5)6)9-7-8-10-22-18(28)17(27)16(26)15(25)14(24)12-23/h13-18,22-28H,7-12H2,1-6H3 |
| InChIKey | SKZGLWNQUITWQG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 159.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|