C18H19N5O — CID 158542587
[2-[5-amino-6-(1H-benzimidazol-2-yl)pyrazin-2-yl]phenyl]methanol;molecular hydrogen (PubChem CID 158542587) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is [2-[5-amino-6-(1H-benzimidazol-2-yl)pyrazin-2-yl]phenyl]methanol;molecular hydrogen.
| Compound Name | [2-[5-amino-6-(1H-benzimidazol-2-yl)pyrazin-2-yl]phenyl]methanol;molecular hydrogen |
|---|---|
| PubChem CID | 158542587 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | [2-[5-amino-6-(1H-benzimidazol-2-yl)pyrazin-2-yl]phenyl]methanol;molecular hydrogen |
| SMILES | Nc1ncc(-c2ccccc2CO)nc1-c1nc2ccccc2[nH]1.[H][H].[H][H] |
| InChI | InChI=1S/C18H15N5O.2H2/c19-17-16(18-22-13-7-3-4-8-14(13)23-18)21-15(9-20-17)12-6-2-1-5-11(12)10-24;;/h1-9,24H,10H2,(H2,19,20)(H,22,23);2*1H |
| InChIKey | HOSBKWHVLLCIRS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |