C26H35N5O3 — CID 158542724
tert-butyl formate;2,2-dimethyl-1-[2-(4-piperazin-1-ylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one (PubChem CID 158542724) has the molecular formula C26H35N5O3 and a molecular weight of 465.60 g/mol. Its IUPAC name is tert-butyl formate;2,2-dimethyl-1-[2-(4-piperazin-1-ylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one.
| Compound Name | tert-butyl formate;2,2-dimethyl-1-[2-(4-piperazin-1-ylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one |
|---|---|
| PubChem CID | 158542724 |
| Molecular Formula | C26H35N5O3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | tert-butyl formate;2,2-dimethyl-1-[2-(4-piperazin-1-ylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one |
| SMILES | CC(C)(C)C(=O)c1c[nH]c2ncc(-c3ccc(N4CCNCC4)cc3)nc12.CC(C)(C)OC=O |
| InChI | InChI=1S/C21H25N5O.C5H10O2/c1-21(2,3)19(27)16-12-23-20-18(16)25-17(13-24-20)14-4-6-15(7-5-14)26-10-8-22-9-11-26;1-5(2,3)7-4-6/h4-7,12-13,22H,8-11H2,1-3H3,(H,23,24);4H,1-3H3 |
| InChIKey | HOSNSDBXIJNIFZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|