C23H26N4OS — CID 59540650
1-[2-[3-[(3aR,6aS)-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrol-5-yl]phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropan-1-one (PubChem CID 59540650) has the molecular formula C23H26N4OS and a molecular weight of 406.56 g/mol. Its IUPAC name is 1-[2-[3-[(3aR,6aS)-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrol-5-yl]phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[2-[3-[(3aR,6aS)-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrol-5-yl]phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 59540650 |
| Molecular Formula | C23H26N4OS |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 1-[2-[3-[(3aR,6aS)-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrol-5-yl]phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)c1c[nH]c2ncc(-c3cccc(N4C[C@H]5CSC[C@H]5C4)c3)nc12 |
| InChI | InChI=1S/C23H26N4OS/c1-23(2,3)21(28)18-8-24-22-20(18)26-19(9-25-22)14-5-4-6-17(7-14)27-10-15-12-29-13-16(15)11-27/h4-9,15-16H,10-13H2,1-3H3,(H,24,25)/t15-,16+ |
| InChIKey | DTHXLYLRVWAODN-IYBDPMFKSA-N |
| XLogP | 4.65 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |