C10H17N — CID 15854281
N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]ethanamine (PubChem CID 15854281) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]ethanamine.
| Compound Name | N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]ethanamine |
|---|---|
| PubChem CID | 15854281 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]ethanamine |
| SMILES | CCNC[C@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C10H17N/c1-2-11-7-10-6-8-3-4-9(10)5-8/h3-4,8-11H,2,5-7H2,1H3/t8-,9+,10+/m0/s1 |
| InChIKey | VMYVYQRZCLDPNG-IVZWLZJFSA-N |
| XLogP | 1.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|