About chloromethane;(4-fluorophenyl)hydrazine
chloromethane;(4-fluorophenyl)hydrazine (PubChem CID 158547421) has the molecular formula C7H10ClFN2
and a molecular weight of 176.62 g/mol. Its IUPAC name is chloromethane;(4-fluorophenyl)hydrazine.
Molecular Properties
| Compound Name | chloromethane;(4-fluorophenyl)hydrazine |
| PubChem CID | 158547421 |
| Molecular Formula | C7H10ClFN2 |
| Molecular Weight | 176.62 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | chloromethane;(4-fluorophenyl)hydrazine |
| SMILES | CCl.NNc1ccc(F)cc1 |
| InChI | InChI=1S/C6H7FN2.CH3Cl/c7-5-1-3-6(9-8)4-2-5;1-2/h1-4,9H,8H2;1H3 |
| InChIKey | HPHGUPDLIRHJBO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.62 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;(4-fluorophenyl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;(4-fluorophenyl)hydrazine?
The IUPAC name of chloromethane;(4-fluorophenyl)hydrazine (CID 158547421) is chloromethane;(4-fluorophenyl)hydrazine.
What is the SMILES notation for chloromethane;(4-fluorophenyl)hydrazine?
The canonical SMILES for chloromethane;(4-fluorophenyl)hydrazine is CCl.NNc1ccc(F)cc1.
What is the InChIKey of chloromethane;(4-fluorophenyl)hydrazine?
The InChIKey is HPHGUPDLIRHJBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7FN2.CH3Cl/c7-5-1-3-6(9-8)4-2-5;1-2/h1-4,9H,8H2;1H3.
What are the key properties of chloromethane;(4-fluorophenyl)hydrazine?
chloromethane;(4-fluorophenyl)hydrazine has a molecular weight of 176.62 g/mol, XLogP of 1.97, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;(4-fluorophenyl)hydrazine is sourced from PubChem (CID 158547421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).