C42H71Cl7N6O6 — CID 158548096
bis(3-(3,3-dichloro-2-methylpropyl)-1,4-dimethyl-6-(2-methylpropyl)piperazine-2,5-dione);1,4-dimethyl-3-(2-methylpropyl)-6-(3,3,3-trichloro-2-methylpropyl)piperazine-2,5-dione (PubChem CID 158548096) has the molecular formula C42H71Cl7N6O6 and a molecular weight of 1004.24 g/mol. Its IUPAC name is bis(3-(3,3-dichloro-2-methylpropyl)-1,4-dimethyl-6-(2-methylpropyl)piperazine-2,5-dione);1,4-dimethyl-3-(2-methylpropyl)-6-(3,3,3-trichloro-2-methylpropyl)piperazine-2,5-dione.
| Compound Name | bis(3-(3,3-dichloro-2-methylpropyl)-1,4-dimethyl-6-(2-methylpropyl)piperazine-2,5-dione);1,4-dimethyl-3-(2-methylpropyl)-6-(3,3,3-trichloro-2-methylpropyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 158548096 |
| Molecular Formula | C42H71Cl7N6O6 |
| Molecular Weight | 1004.24 g/mol |
| Exact Mass | 1000.33 |
| IUPAC Name | bis(3-(3,3-dichloro-2-methylpropyl)-1,4-dimethyl-6-(2-methylpropyl)piperazine-2,5-dione);1,4-dimethyl-3-(2-methylpropyl)-6-(3,3,3-trichloro-2-methylpropyl)piperazine-2,5-dione |
| SMILES | CC(C)CC1C(=O)N(C)C(CC(C)C(Cl)(Cl)Cl)C(=O)N1C.CC(C)CC1C(=O)N(C)C(CC(C)C(Cl)Cl)C(=O)N1C.CC(C)CC1C(=O)N(C)C(CC(C)C(Cl)Cl)C(=O)N1C |
| InChI | InChI=1S/C14H23Cl3N2O2.2C14H24Cl2N2O2/c1-8(2)6-10-12(20)19(5)11(13(21)18(10)4)7-9(3)14(15,16)17;2*1-8(2)6-10-13(19)18(5)11(14(20)17(10)4)7-9(3)12(15)16/h8-11H,6-7H2,1-5H3;2*8-12H,6-7H2,1-5H3 |
| InChIKey | HPJMKFQHOVGPAV-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 121.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1004.24 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|