C14H22Cl4N2O2 — CID 73175243
3,6-bis(3,3-dichloro-2-methylpropyl)-1,4-dimethylpiperazine-2,5-dione (PubChem CID 73175243) has the molecular formula C14H22Cl4N2O2 and a molecular weight of 392.15 g/mol. Its IUPAC name is 3,6-bis(3,3-dichloro-2-methylpropyl)-1,4-dimethylpiperazine-2,5-dione.
| Compound Name | 3,6-bis(3,3-dichloro-2-methylpropyl)-1,4-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 73175243 |
| Molecular Formula | C14H22Cl4N2O2 |
| Molecular Weight | 392.15 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 3,6-bis(3,3-dichloro-2-methylpropyl)-1,4-dimethylpiperazine-2,5-dione |
| SMILES | CC(CC1C(=O)N(C)C(CC(C)C(Cl)Cl)C(=O)N1C)C(Cl)Cl |
| InChI | InChI=1S/C14H22Cl4N2O2/c1-7(11(15)16)5-9-13(21)20(4)10(14(22)19(9)3)6-8(2)12(17)18/h7-12H,5-6H2,1-4H3 |
| InChIKey | VRQZGAPBWYEDHZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.15 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|