C14H21Cl3N2O2 — CID 135574497
(3S,6E)-3-[(2S)-3-chloro-2-methylpropyl]-6-[(2R)-3,3-dichloro-2-methylpropylidene]-1,4-dimethylpiperazine-2,5-dione (PubChem CID 135574497) has the molecular formula C14H21Cl3N2O2 and a molecular weight of 355.69 g/mol. Its IUPAC name is (3S,6E)-3-[(2S)-3-chloro-2-methylpropyl]-6-[(2R)-3,3-dichloro-2-methylpropylidene]-1,4-dimethylpiperazine-2,5-dione.
| Compound Name | (3S,6E)-3-[(2S)-3-chloro-2-methylpropyl]-6-[(2R)-3,3-dichloro-2-methylpropylidene]-1,4-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 135574497 |
| Molecular Formula | C14H21Cl3N2O2 |
| Molecular Weight | 355.69 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | (3S,6E)-3-[(2S)-3-chloro-2-methylpropyl]-6-[(2R)-3,3-dichloro-2-methylpropylidene]-1,4-dimethylpiperazine-2,5-dione |
| SMILES | C[C@H](CCl)C[C@H]1C(=O)N(C)/C(=C/[C@@H](C)C(Cl)Cl)C(=O)N1C |
| InChI | InChI=1S/C14H21Cl3N2O2/c1-8(7-15)5-10-13(20)19(4)11(14(21)18(10)3)6-9(2)12(16)17/h6,8-10,12H,5,7H2,1-4H3/b11-6+/t8-,9+,10-/m0/s1 |
| InChIKey | GKYGSNSRYKQYTK-JYWYSSHUSA-N |
| XLogP | 2.87 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.69 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|