C21H28O4 — CID 158553104
6,6-dideuterio-1-(2,3,4,6-tetradeuterio-5-methylphenoxy)-6-[2,3,6-trideuterio-5-methoxy-4-(trideuteriomethoxy)phenyl]hexan-2-ol (PubChem CID 158553104) has the molecular formula C21H28O4 and a molecular weight of 356.52 g/mol. Its IUPAC name is 6,6-dideuterio-1-(2,3,4,6-tetradeuterio-5-methylphenoxy)-6-[2,3,6-trideuterio-5-methoxy-4-(trideuteriomethoxy)phenyl]hexan-2-ol.
| Compound Name | 6,6-dideuterio-1-(2,3,4,6-tetradeuterio-5-methylphenoxy)-6-[2,3,6-trideuterio-5-methoxy-4-(trideuteriomethoxy)phenyl]hexan-2-ol |
|---|---|
| PubChem CID | 158553104 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 6,6-dideuterio-1-(2,3,4,6-tetradeuterio-5-methylphenoxy)-6-[2,3,6-trideuterio-5-methoxy-4-(trideuteriomethoxy)phenyl]hexan-2-ol |
| SMILES | [2H]c1c([2H])c(C)c([2H])c(OCC(O)CCCC([2H])([2H])c2c([2H])c([2H])c(OC([2H])([2H])[2H])c(OC)c2[2H])c1[2H] |
| InChI | InChI=1S/C21H28O4/c1-16-7-6-10-19(13-16)25-15-18(22)9-5-4-8-17-11-12-20(23-2)21(14-17)24-3/h6-7,10-14,18,22H,4-5,8-9,15H2,1-3H3/i2D3,6D,7D,8D2,10D,11D,12D,13D,14D |
| InChIKey | OXAGHCVBQFNTPQ-MJCQXVRISA-N |
| XLogP | 4.16 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |