C22H30O4 — CID 158257954
6-(2,3,6-trideuterio-4,5-dimethoxyphenyl)-1-(2,3,6-trideuterio-4,5-dimethylphenoxy)hexan-2-ol (PubChem CID 158257954) has the molecular formula C22H30O4 and a molecular weight of 364.51 g/mol. Its IUPAC name is 6-(2,3,6-trideuterio-4,5-dimethoxyphenyl)-1-(2,3,6-trideuterio-4,5-dimethylphenoxy)hexan-2-ol.
| Compound Name | 6-(2,3,6-trideuterio-4,5-dimethoxyphenyl)-1-(2,3,6-trideuterio-4,5-dimethylphenoxy)hexan-2-ol |
|---|---|
| PubChem CID | 158257954 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 6-(2,3,6-trideuterio-4,5-dimethoxyphenyl)-1-(2,3,6-trideuterio-4,5-dimethylphenoxy)hexan-2-ol |
| SMILES | [2H]c1c([2H])c(OCC(O)CCCCc2c([2H])c([2H])c(OC)c(OC)c2[2H])c([2H])c(C)c1C |
| InChI | InChI=1S/C22H30O4/c1-16-9-11-20(13-17(16)2)26-15-19(23)8-6-5-7-18-10-12-21(24-3)22(14-18)25-4/h9-14,19,23H,5-8,15H2,1-4H3/i9D,10D,11D,12D,13D,14D |
| InChIKey | RDUKZXSXFXGLKW-GYJXWMDOSA-N |
| XLogP | 4.47 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|