C27H30N4O3 — CID 158557459
5-[2-[[4-[(2-methoxyethylamino)methyl]phenyl]methyl]pyrimidin-4-yl]-2-(oxan-4-yloxy)benzonitrile (PubChem CID 158557459) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is 5-[2-[[4-[(2-methoxyethylamino)methyl]phenyl]methyl]pyrimidin-4-yl]-2-(oxan-4-yloxy)benzonitrile.
| Compound Name | 5-[2-[[4-[(2-methoxyethylamino)methyl]phenyl]methyl]pyrimidin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
|---|---|
| PubChem CID | 158557459 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 5-[2-[[4-[(2-methoxyethylamino)methyl]phenyl]methyl]pyrimidin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
| SMILES | COCCNCc1ccc(Cc2nccc(-c3ccc(OC4CCOCC4)c(C#N)c3)n2)cc1 |
| InChI | InChI=1S/C27H30N4O3/c1-32-15-12-29-19-21-4-2-20(3-5-21)16-27-30-11-8-25(31-27)22-6-7-26(23(17-22)18-28)34-24-9-13-33-14-10-24/h2-8,11,17,24,29H,9-10,12-16,19H2,1H3 |
| InChIKey | QZRQRDKFUHKIRD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|