C30H35N5O4 — CID 160887173
4-[[4-[3-cyano-4-(oxan-4-yloxy)phenyl]pyrimidin-2-yl]methyl]-N-[3-(dimethylamino)propyl]-2-methoxybenzamide (PubChem CID 160887173) has the molecular formula C30H35N5O4 and a molecular weight of 529.64 g/mol. Its IUPAC name is 4-[[4-[3-cyano-4-(oxan-4-yloxy)phenyl]pyrimidin-2-yl]methyl]-N-[3-(dimethylamino)propyl]-2-methoxybenzamide.
| Compound Name | 4-[[4-[3-cyano-4-(oxan-4-yloxy)phenyl]pyrimidin-2-yl]methyl]-N-[3-(dimethylamino)propyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 160887173 |
| Molecular Formula | C30H35N5O4 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | 4-[[4-[3-cyano-4-(oxan-4-yloxy)phenyl]pyrimidin-2-yl]methyl]-N-[3-(dimethylamino)propyl]-2-methoxybenzamide |
| SMILES | COc1cc(Cc2nccc(-c3ccc(OC4CCOCC4)c(C#N)c3)n2)ccc1C(=O)NCCCN(C)C |
| InChI | InChI=1S/C30H35N5O4/c1-35(2)14-4-12-33-30(36)25-7-5-21(17-28(25)37-3)18-29-32-13-9-26(34-29)22-6-8-27(23(19-22)20-31)39-24-10-15-38-16-11-24/h5-9,13,17,19,24H,4,10-12,14-16,18H2,1-3H3,(H,33,36) |
| InChIKey | SNUHUGJUNANZLN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|