C34H41N3O7 — CID 148807989
tert-butyl 4-[2-[5-[[4-[3-cyano-4-(oxan-4-yloxy)phenyl]pyrimidin-2-yl]methyl]-2-methoxyphenoxy]ethoxy]butanoate (PubChem CID 148807989) has the molecular formula C34H41N3O7 and a molecular weight of 603.72 g/mol. Its IUPAC name is tert-butyl 4-[2-[5-[[4-[3-cyano-4-(oxan-4-yloxy)phenyl]pyrimidin-2-yl]methyl]-2-methoxyphenoxy]ethoxy]butanoate.
| Compound Name | tert-butyl 4-[2-[5-[[4-[3-cyano-4-(oxan-4-yloxy)phenyl]pyrimidin-2-yl]methyl]-2-methoxyphenoxy]ethoxy]butanoate |
|---|---|
| PubChem CID | 148807989 |
| Molecular Formula | C34H41N3O7 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.29 |
| IUPAC Name | tert-butyl 4-[2-[5-[[4-[3-cyano-4-(oxan-4-yloxy)phenyl]pyrimidin-2-yl]methyl]-2-methoxyphenoxy]ethoxy]butanoate |
| SMILES | COc1ccc(Cc2nccc(-c3ccc(OC4CCOCC4)c(C#N)c3)n2)cc1OCCOCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H41N3O7/c1-34(2,3)44-33(38)6-5-15-40-18-19-42-31-20-24(7-9-30(31)39-4)21-32-36-14-11-28(37-32)25-8-10-29(26(22-25)23-35)43-27-12-16-41-17-13-27/h7-11,14,20,22,27H,5-6,12-13,15-19,21H2,1-4H3 |
| InChIKey | OPIPGYJDHHIFCX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 122.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|