C13H15FN2O2 — CID 158557663
cis-(1R,3S)-3-aminocyclopentane-1-carboxylic acid;1-fluoro-4-isocyanobenzene (PubChem CID 158557663) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is cis-(1R,3S)-3-aminocyclopentane-1-carboxylic acid;1-fluoro-4-isocyanobenzene.
| Compound Name | cis-(1R,3S)-3-aminocyclopentane-1-carboxylic acid;1-fluoro-4-isocyanobenzene |
|---|---|
| PubChem CID | 158557663 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | cis-(1R,3S)-3-aminocyclopentane-1-carboxylic acid;1-fluoro-4-isocyanobenzene |
| SMILES | N[C@H]1CC[C@@H](C(=O)O)C1.[C-]#[N+]c1ccc(F)cc1 |
| InChI | InChI=1S/C7H4FN.C6H11NO2/c1-9-7-4-2-6(8)3-5-7;7-5-2-1-4(3-5)6(8)9/h2-5H;4-5H,1-3,7H2,(H,8,9)/t;4-,5+/m.1/s1 |
| InChIKey | HQMJPHKPLQLJJT-SJGICDGZSA-N |
| XLogP | 2.57 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|