C16H23ClN4O3 — CID 158558177
2-methoxyethyl 4-[[(3R)-piperidin-3-yl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate;hydrochloride (PubChem CID 158558177) has the molecular formula C16H23ClN4O3 and a molecular weight of 354.84 g/mol. Its IUPAC name is 2-methoxyethyl 4-[[(3R)-piperidin-3-yl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate;hydrochloride.
| Compound Name | 2-methoxyethyl 4-[[(3R)-piperidin-3-yl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 158558177 |
| Molecular Formula | C16H23ClN4O3 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-methoxyethyl 4-[[(3R)-piperidin-3-yl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate;hydrochloride |
| SMILES | COCCOC(=O)c1cnc2[nH]ccc2c1N[C@@H]1CCCNC1.Cl |
| InChI | InChI=1S/C16H22N4O3.ClH/c1-22-7-8-23-16(21)13-10-19-15-12(4-6-18-15)14(13)20-11-3-2-5-17-9-11;/h4,6,10-11,17H,2-3,5,7-9H2,1H3,(H2,18,19,20);1H/t11-;/m1./s1 |
| InChIKey | AVCBAXRYNDPMBP-RFVHGSKJSA-N |
| XLogP | 1.95 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|