C17H24NO2W- — CID 158558407
carbanide;(2E)-2-(hydroxymethylidene)-1-phenyl-4-piperidin-1-ylbutan-1-one;tungsten (PubChem CID 158558407) has the molecular formula C17H24NO2W- and a molecular weight of 458.22 g/mol. Its IUPAC name is carbanide;(2E)-2-(hydroxymethylidene)-1-phenyl-4-piperidin-1-ylbutan-1-one;tungsten.
| Compound Name | carbanide;(2E)-2-(hydroxymethylidene)-1-phenyl-4-piperidin-1-ylbutan-1-one;tungsten |
|---|---|
| PubChem CID | 158558407 |
| Molecular Formula | C17H24NO2W- |
| Molecular Weight | 458.22 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | carbanide;(2E)-2-(hydroxymethylidene)-1-phenyl-4-piperidin-1-ylbutan-1-one;tungsten |
| SMILES | O=C(/C(=C/O)CCN1CCCCC1)c1ccccc1.[CH3-].[W] |
| InChI | InChI=1S/C16H21NO2.CH3.W/c18-13-15(9-12-17-10-5-2-6-11-17)16(19)14-7-3-1-4-8-14;;/h1,3-4,7-8,13,18H,2,5-6,9-12H2;1H3;/q;-1;/b15-13+;; |
| InChIKey | TZWZUJGNFAEPCF-MURRALTGSA-N |
| XLogP | 3.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|