C12H8ClF3O2 — CID 158558781
4-chloro-3-fluorophenol;3,4-difluorophenol (PubChem CID 158558781) has the molecular formula C12H8ClF3O2 and a molecular weight of 276.64 g/mol. Its IUPAC name is 4-chloro-3-fluorophenol;3,4-difluorophenol.
| Compound Name | 4-chloro-3-fluorophenol;3,4-difluorophenol |
|---|---|
| PubChem CID | 158558781 |
| Molecular Formula | C12H8ClF3O2 |
| Molecular Weight | 276.64 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 4-chloro-3-fluorophenol;3,4-difluorophenol |
| SMILES | Oc1ccc(Cl)c(F)c1.Oc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C6H4ClFO.C6H4F2O/c2*7-5-2-1-4(9)3-6(5)8/h2*1-3,9H |
| InChIKey | HQPUYBAPNLNVDN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.64 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |