C21H19ClFN3O2 — CID 158558850
2-(2-chloro-4-morpholin-2-ylphenyl)-1-[1-(4-fluorophenyl)pyrazol-4-yl]ethanone (PubChem CID 158558850) has the molecular formula C21H19ClFN3O2 and a molecular weight of 399.85 g/mol. Its IUPAC name is 2-(2-chloro-4-morpholin-2-ylphenyl)-1-[1-(4-fluorophenyl)pyrazol-4-yl]ethanone.
| Compound Name | 2-(2-chloro-4-morpholin-2-ylphenyl)-1-[1-(4-fluorophenyl)pyrazol-4-yl]ethanone |
|---|---|
| PubChem CID | 158558850 |
| Molecular Formula | C21H19ClFN3O2 |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 2-(2-chloro-4-morpholin-2-ylphenyl)-1-[1-(4-fluorophenyl)pyrazol-4-yl]ethanone |
| SMILES | O=C(Cc1ccc(C2CNCCO2)cc1Cl)c1cnn(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H19ClFN3O2/c22-19-9-15(21-12-24-7-8-28-21)2-1-14(19)10-20(27)16-11-25-26(13-16)18-5-3-17(23)4-6-18/h1-6,9,11,13,21,24H,7-8,10,12H2 |
| InChIKey | HQQASTTWNGYDNS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |