C28H28FN5O5S — CID 158566358
tert-butyl 2-[6-[3-(4-cyano-3-methylphenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-8-fluoroquinazolin-4-yl]oxyethyl carbonate (PubChem CID 158566358) has the molecular formula C28H28FN5O5S and a molecular weight of 565.63 g/mol. Its IUPAC name is tert-butyl 2-[6-[3-(4-cyano-3-methylphenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-8-fluoroquinazolin-4-yl]oxyethyl carbonate.
| Compound Name | tert-butyl 2-[6-[3-(4-cyano-3-methylphenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-8-fluoroquinazolin-4-yl]oxyethyl carbonate |
|---|---|
| PubChem CID | 158566358 |
| Molecular Formula | C28H28FN5O5S |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | tert-butyl 2-[6-[3-(4-cyano-3-methylphenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-8-fluoroquinazolin-4-yl]oxyethyl carbonate |
| SMILES | Cc1cc(N2C(=O)C(C)(C)N(c3cc(F)c4ncnc(OCCOC(=O)OC(C)(C)C)c4c3)C2=S)ccc1C#N |
| InChI | InChI=1S/C28H28FN5O5S/c1-16-11-18(8-7-17(16)14-30)33-24(35)28(5,6)34(25(33)40)19-12-20-22(21(29)13-19)31-15-32-23(20)37-9-10-38-26(36)39-27(2,3)4/h7-8,11-13,15H,9-10H2,1-6H3 |
| InChIKey | ADKBFTDLDUYPBA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 117.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|