About 3-phenyl-1-propan-2-yl-6-(trifluoromethyl)-2H-imidazo[4,5-b]pyridine iodide
3-phenyl-1-propan-2-yl-6-(trifluoromethyl)-2H-imidazo[4,5-b]pyridine iodide (PubChem CID 158567085) has the molecular formula C16H16F3IN3-
and a molecular weight of 434.22 g/mol. Its IUPAC name is 3-phenyl-1-propan-2-yl-6-(trifluoromethyl)-2H-imidazo[4,5-b]pyridine iodide.
Molecular Properties
| Compound Name | 3-phenyl-1-propan-2-yl-6-(trifluoromethyl)-2H-imidazo[4,5-b]pyridine iodide |
| PubChem CID | 158567085 |
| Molecular Formula | C16H16F3IN3- |
| Molecular Weight | 434.22 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 3-phenyl-1-propan-2-yl-6-(trifluoromethyl)-2H-imidazo[4,5-b]pyridine iodide |
| SMILES | CC(C)N1CN(c2ccccc2)c2ncc(C(F)(F)F)cc21.[I-] |
| InChI | InChI=1S/C16H16F3N3.HI/c1-11(2)21-10-22(13-6-4-3-5-7-13)15-14(21)8-12(9-20-15)16(17,18)19;/h3-9,11H,10H2,1-2H3;1H/p-1 |
| InChIKey | HRPPYQUWZQNQDR-UHFFFAOYSA-M |
| XLogP | 1.43 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-1-propan-2-yl-6-(trifluoromethyl)-2H-imidazo[4,5-b]pyridine iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1-propan-2-yl-6-(trifluoromethyl)-2H-imidazo[4,5-b]pyridine iodide?
The IUPAC name of 3-phenyl-1-propan-2-yl-6-(trifluoromethyl)-2H-imidazo[4,5-b]pyridine iodide (CID 158567085) is 3-phenyl-1-propan-2-yl-6-(trifluoromethyl)-2H-imidazo[4,5-b]pyridine iodide.
What is the SMILES notation for 3-phenyl-1-propan-2-yl-6-(trifluoromethyl)-2H-imidazo[4,5-b]pyridine iodide?
The canonical SMILES for 3-phenyl-1-propan-2-yl-6-(trifluoromethyl)-2H-imidazo[4,5-b]pyridine iodide is CC(C)N1CN(c2ccccc2)c2ncc(C(F)(F)F)cc21.[I-].
What is the InChIKey of 3-phenyl-1-propan-2-yl-6-(trifluoromethyl)-2H-imidazo[4,5-b]pyridine iodide?
The InChIKey is HRPPYQUWZQNQDR-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H16F3N3.HI/c1-11(2)21-10-22(13-6-4-3-5-7-13)15-14(21)8-12(9-20-15)16(17,18)19;/h3-9,11H,10H2,1-2H3;1H/p-1.
What are the key properties of 3-phenyl-1-propan-2-yl-6-(trifluoromethyl)-2H-imidazo[4,5-b]pyridine iodide?
3-phenyl-1-propan-2-yl-6-(trifluoromethyl)-2H-imidazo[4,5-b]pyridine iodide has a molecular weight of 434.22 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1-propan-2-yl-6-(trifluoromethyl)-2H-imidazo[4,5-b]pyridine iodide is sourced from PubChem (CID 158567085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).